2-diphenylarsanylethenyl(diphenyl)arsane structure
|
Common Name | 2-diphenylarsanylethenyl(diphenyl)arsane | ||
|---|---|---|---|---|
| CAS Number | 15924-20-6 | Molecular Weight | 484.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22As2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-diphenylarsanylethenyl(diphenyl)arsane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H22As2 |
|---|---|
| Molecular Weight | 484.29600 |
| Exact Mass | 484.01500 |
| LogP | 3.23940 |
| InChIKey | BMLQMBNMABZTIG-UHFFFAOYSA-N |
| SMILES | C(=C[As](c1ccccc1)c1ccccc1)[As](c1ccccc1)c1ccccc1 |
|
~89%
2-diphenylarsan... CAS#:15924-20-6 |
| Literature: Carlson, Brenden; Phelan, Gregory D.; Kaminsky, Werner; Dalton, Larry; Jiang, Xuezhong; Liu, Sen; Jen, Alex K.-Y. Journal of the American Chemical Society, 2002 , vol. 124, # 47 p. 14162 - 14172 |
| Arsine,(1Z)-1,2-ethenediylbis[diphenyl |
| cis-1,2-bis(diphenylarsino)ethene |
| Z-1,2-bis-(diphenylarsino)-ethene |
| cis-1,2-vinylenebis(diphenylarsine) |
| cis-1,2-Bis(diphenylarsino)ethen |
| cis-Vinylen-bis-(diphenylarsin) |