1-Boc-4-(4-methoxycarbonylphenyl)piperazine
Modify Date: 2025-08-25 18:30:37
1-Boc-4-(4-methoxycarbonylphenyl)piperazine structure
|
Common Name | 1-Boc-4-(4-methoxycarbonylphenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 158985-36-5 | Molecular Weight | 320.384 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 451.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H24N2O4 | Melting Point | 166-167ºC | |
| MSDS | Chinese USA | Flash Point | 227.0±27.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | tert-butyl 4-(4-methoxycarbonylphenyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.7±40.0 °C at 760 mmHg |
| Melting Point | 166-167ºC |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.384 |
| Flash Point | 227.0±27.3 °C |
| Exact Mass | 320.173615 |
| PSA | 59.08000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | SMDBCJAJWDCJOP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H319 |
| Precautionary Statements | P264-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R25;R52/53 |
| Safety Phrases | 45 |
| RIDADR | UN 2811 |
| WGK Germany | 2 |
| HS Code | 2933599090 |
|
~%
1-Boc-4-(4-meth... CAS#:158985-36-5 |
| Literature: WO2003/105853 A1, ; Page 41 ; WO 03/105853 A1 |
|
~%
1-Boc-4-(4-meth... CAS#:158985-36-5 |
| Literature: WO2006/38039 A1, ; Page/Page column 15 ; |
|
~%
1-Boc-4-(4-meth... CAS#:158985-36-5 |
| Literature: US2003/186962 A1, ; |
|
~%
1-Boc-4-(4-meth... CAS#:158985-36-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 15 p. 4646 - 4661 |
CAS#:158985-37-6![4-[4-(tert-Butoxycarbonyl)piperazino]benzoic acid structure](https://image.chemsrc.com/caspic/483/162046-66-4.png)
CAS#:162046-66-4| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-(4-(methoxycarbonyl)phenyl)piperazine-1-carboxylate |
| 1-(tert-Butoxycarbonyl)-4-(4-hydroxymethylphenyl)piperazine |
| 2-Methyl-2-propanyl 4-[4-(methoxycarbonyl)phenyl]-1-piperazinecarboxylate |
| 4-[4-(methoxycarbonyl)phenyl]-1-piperazinecarboxylic acid 1,1-dimethylethyl ester |
| tert-Butyl 4-[4-(methoxycarbonyl)phenyl]piperazine-1-carboxylate |
| 1-(tert-butoxycarbonyl)-4-(4-methoxycarbonylphenyl)piperazine |
| TERT-BUTYL 4-[4-(HYDROXYMETHYL)PHENYL]TETRAHYDRO-1(2H)-PYRAZINECARBOXYLATE |
| 4-(4-methoxycarbonyl-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |
| 4-[4-(Methoxycarbonyl)phenyl]-1-piperazinecarboxylic acid, 1,1-dimethylethyl ester |
| Methyl 4-(N-Boc-N'-piperazinyl)benzoate |
| 1-hydroxymethyl-4-(4-(1,1-dimethylethoxycarbonyl)piperazinyl)benzene |
| 4-(4-N-Boc-piperazinyl)benzylalcohol |
| 1-Piperazinecarboxylic acid, 4-[4-(methoxycarbonyl)phenyl]-, 1,1-dimethylethyl ester |
| tert-Butyl 4-(4-(hydroxymethyl)phenyl)piperazine-1-carboxylate |