2,5-Dibromo-3-nitropyridine structure
|
Common Name | 2,5-Dibromo-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 15862-37-0 | Molecular Weight | 281.890 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 272.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2Br2N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 118.7±25.9 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2,5-Dibromo-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.7±35.0 °C at 760 mmHg |
| Molecular Formula | C5H2Br2N2O2 |
| Molecular Weight | 281.890 |
| Flash Point | 118.7±25.9 °C |
| Exact Mass | 279.848297 |
| PSA | 58.71000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | OQKWPJCAKRVADO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1Br |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | 25 |
| Safety Phrases | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933399090 |
|
~97%
2,5-Dibromo-3-n... CAS#:15862-37-0 |
| Literature: F. HOFFMANN-LA ROCHE AG; AEBI, Johannes; BINGGELI, Alfred; HERTEL, Cornelia; KONKAR, Anish Ashok; KUEHNE, Holger; KUHN, Bernd; MAERKI, Hans P.; WANG, Haiyan Patent: WO2012/89601 A1, 2012 ; Location in patent: Page/Page column 53 ; WO 2012/089601 A1 |
|
~60%
2,5-Dibromo-3-n... CAS#:15862-37-0 |
| Literature: BANYU PHARMACEUTICAL CO., LTD. Patent: EP1757594 A1, 2007 ; Location in patent: Page/Page column 76 ; EP 1757594 A1 |
|
~%
2,5-Dibromo-3-n... CAS#:15862-37-0 |
| Literature: US5445763 A1, ; |
|
~%
2,5-Dibromo-3-n... CAS#:15862-37-0 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 6053 |
|
~%
2,5-Dibromo-3-n... CAS#:15862-37-0 |
| Literature: Tetrahedron, , vol. 59, # 43 p. 8555 - 8570 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2,5-dibromo-3-nitro- |
| 2,4-DICHLORO-N-(2-METHYLBENZYL)ANILINE |
| 2,5-Dibromo-3-nitropyridine |
| 2,5-Dibrom-3-nitro-pyridin |
| 2,5-Dibromo-3-nitro-pyridine |
| MFCD09266223 |