Octafluoro-9,10-anthraquinone
Modify Date: 2025-12-01 13:23:09
Octafluoro-9,10-anthraquinone structure
|
Common Name | Octafluoro-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 1580-18-3 | Molecular Weight | 352.13600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14F8O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 1,2,3,4,5,6,7,8-octafluoroanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14F8O2 |
|---|---|
| Molecular Weight | 352.13600 |
| Exact Mass | 351.97700 |
| PSA | 34.14000 |
| LogP | 3.57480 |
| InChIKey | JHJWVVOLGHMBPQ-UHFFFAOYSA-N |
| SMILES | O=C1c2c(F)c(F)c(F)c(F)c2C(=O)c2c(F)c(F)c(F)c(F)c21 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2914700090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1580-19-4| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
9,10-Dichlorooctafluoroanthracene as a building block for n-type organic semiconductors.
J. Org. Chem. 72 , 5567-5573, (2007) 9,10-Dichlorooctafluoroanthracene (1) was synthesized from commercially available tetrafluorophthalic acid by an optimized solution-phase route. To establish 1 as a synthon for n-type organic semicond... |
| OCTAFLUOROANTHRAQUINONE |
| Octafluoroanthraquinone |