2-Nitro-5-(1-piperidinyl)phenol structure
|
Common Name | 2-Nitro-5-(1-piperidinyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 157831-75-9 | Molecular Weight | 222.24000 | |
| Density | 1.292g/cm3 | Boiling Point | 397.6ºC at 760mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | 68-70ºC | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 2-nitro-5-piperidin-1-ylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 397.6ºC at 760mmHg |
| Melting Point | 68-70ºC |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 194.2ºC |
| Exact Mass | 222.10000 |
| PSA | 69.29000 |
| LogP | 2.87890 |
| Vapour Pressure | 6.87E-07mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | DDKAQSBPHIORAR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCCCC2)cc1O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-nitro-5-(piperidin-1'-yl)phenol |
| 2-nitro-5-piperidylphenol |
| 2-nitro-5-piperidinophenol |
| MFCD00052663 |