2-Bromo-3-pyridinyl trifluoromethanesulfonate
Modify Date: 2025-08-21 14:29:13
2-Bromo-3-pyridinyl trifluoromethanesulfonate structure
|
Common Name | 2-Bromo-3-pyridinyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 157373-97-2 | Molecular Weight | 306.057 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 319.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H3BrF3NO3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 147.0±27.9 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | (2-bromopyridin-3-yl) trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.4±42.0 °C at 760 mmHg |
| Molecular Formula | C6H3BrF3NO3S |
| Molecular Weight | 306.057 |
| Flash Point | 147.0±27.9 °C |
| Exact Mass | 304.896912 |
| PSA | 64.64000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | DWJIUNKBHIJMPC-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1cccnc1Br)C(F)(F)F |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H315-H319-H335 |
| Precautionary Statements | P261-P264-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R25 |
| Safety Phrases | S26 |
| RIDADR | UN 2810 6.1/PG 3 |
| HS Code | 2933399090 |
|
~96%
2-Bromo-3-pyrid... CAS#:157373-97-2 |
| Literature: McArthur, Silvia Gatti; Goetschi, Erwin; Palmer, Wylie Solang; Wichmann, Juergen; Woltering, Thomas Johannes Patent: US2006/217387 A1, 2006 ; Location in patent: Page/Page column 27 ; US 20060217387 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| trifluoro-methanesulfonic acid 2-bromo-pyridin-3-yl ester |
| 2-bromopyridin-3-yl trifluoromethanesulfonate |
| Methanesulfonic acid,1,1,1-trifluoro-,2-bromo-3-pyridinyl ester |
| 2-Bromo-3-pyridyl triflate |
| Methanesulfonic acid, 1,1,1-trifluoro-, 2-bromo-3-pyridinyl ester |
| 2-bromo-3-triflic pyridinate |
| 2-Bromo-3-pyridinyl trifluoromethanesulfonate |
| 2-Bromo-3-pyridyl trifluoromethanesulfonate |