2-[(3-ethoxy-4-hydroxy-phenyl)methylidene]propanedinitrile
Modify Date: 2025-09-18 16:44:26
![2-[(3-ethoxy-4-hydroxy-phenyl)methylidene]propanedinitrile Structure](https://image.chemsrc.com/caspic/484/15728-34-4.png)
2-[(3-ethoxy-4-hydroxy-phenyl)methylidene]propanedinitrile structure
|
Common Name | 2-[(3-ethoxy-4-hydroxy-phenyl)methylidene]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 15728-34-4 | Molecular Weight | 214.22000 | |
| Density | 1.242g/cm3 | Boiling Point | 390.5ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 2-[(3-ethoxy-4-hydroxyphenyl)methylidene]propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 390.5ºC at 760 mmHg |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 190ºC |
| Exact Mass | 214.07400 |
| PSA | 77.04000 |
| LogP | 2.22146 |
| Vapour Pressure | 1.17E-06mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | NICBMMKNBWCVPN-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C=C(C#N)C#N)ccc1O |
|
~%
2-[(3-ethoxy-4-... CAS#:15728-34-4 |
| Literature: Wells, Geoffrey; Seaton, Angela; Steven, Malcolm F. G. Journal of Medicinal Chemistry, 2000 , vol. 43, # 8 p. 1550 - 1562 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Ethoxy-4-hydroxy-benzalmalonitril |