O-7460(solution)
Modify Date: 2025-08-24 23:26:10
O-7460(solution) structure
|
Common Name | O-7460(solution) | ||
|---|---|---|---|---|
| CAS Number | 1572051-31-0 | Molecular Weight | 478.618 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 536.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H48FO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2±30.1 °C | |
Use of O-7460(solution)O-7460 is a selective inhibitor of 2-AG (2-arachidonoyl glycerol) biosynthesis via diacylglycerol lipase (DAGLα) with an IC50 of 690 nM. |
| Name | O-7460(solution) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.5±50.0 °C at 760 mmHg |
| Molecular Formula | C25H48FO5P |
| Molecular Weight | 478.618 |
| Flash Point | 278.2±30.1 °C |
| Exact Mass | 478.322327 |
| LogP | 8.89 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | ZLEFMXNNQCABDB-SEYXRHQNSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(COC(C)C)COP(C)(=O)F |
| 1-{[Fluoro(methyl)phosphoryl]oxy}-3-isopropoxy-2-propanyl (9Z)-9-octadecenoate |
| O-7460 |
| 9-Octadecenoic acid, 2-[(fluoromethylphosphinyl)oxy]-1-[(1-methylethoxy)methyl]ethyl ester, (9Z)- |