O-benzyl-DL-alanine toluene-p-sulphonate
Modify Date: 2025-09-23 10:24:43
O-benzyl-DL-alanine toluene-p-sulphonate structure
|
Common Name | O-benzyl-DL-alanine toluene-p-sulphonate | ||
|---|---|---|---|---|
| CAS Number | 35386-78-8 | Molecular Weight | 351.41700 | |
| Density | N/A | Boiling Point | 256.5ºC at 760mmHg | |
| Molecular Formula | C17H21NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.6ºC | |
| Name | Benzyl L-alaninate 4-methylbenzenesulfonate (1:1) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 256.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.41700 |
| Flash Point | 119.6ºC |
| Exact Mass | 351.11400 |
| PSA | 115.07000 |
| LogP | 4.09980 |
| InChIKey | NWOPHJSSBMABBD-UHFFFAOYSA-N |
| SMILES | CC(N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| alane*Me2NEt |
| rac-Alanine benzyl ester p-toluenesulfonate |
| (Ethyldimethylamine)trihydroaluminum |
| [AlH3*(DMEA)] |
| Alaninbenzylester-Tosylat |
| Dimethylethylamine alane |
| AlH3*NMe2Et |
| Alane N,N-dimethylethylamine complex solution |
| AlH3*EtNMe2 |