2-(9H-Carbazol-9-yl)ethyl methacrylate structure
|
Common Name | 2-(9H-Carbazol-9-yl)ethyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 15657-91-7 | Molecular Weight | 279.33300 | |
| Density | 1.11g/cm3 | Boiling Point | 397.1ºC at 760 mmHg | |
| Molecular Formula | C18H17NO2 | Melting Point | 72.7-79.4ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 194ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(9H-Carbazol-9-yl)ethyl methacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 397.1ºC at 760 mmHg |
| Melting Point | 72.7-79.4ºC(lit.) |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.33300 |
| Flash Point | 194ºC |
| Exact Mass | 279.12600 |
| PSA | 31.23000 |
| LogP | 3.91380 |
| Vapour Pressure | 1.63E-06mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | PCRXBGQWYLIHKQ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCn1c2ccccc2c2ccccc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-carbazol-9-ylethyl 2-methylprop-2-enoate |
| 9H-Carbazole-9-ethylmethacrylate |
| MFCD00085236 |