2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)acetic acid structure
|
Common Name | 2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 156478-71-6 | Molecular Weight | 244.288 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 365.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H20N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 174.9±26.5 °C | |
| Name | 4-Boc-1-Piperazineacetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.5±37.0 °C at 760 mmHg |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.288 |
| Flash Point | 174.9±26.5 °C |
| Exact Mass | 244.142303 |
| PSA | 70.08000 |
| LogP | 0.92 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | WZBHMXRBXXCEDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(=O)O)CC1 |
| Storage condition | 2~8℃ |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
|
~76%
2-(4-(tert-Buto... CAS#:156478-71-6 |
| Literature: WO2013/53983 A1, ; Page/Page column 42 ; |
|
~%
2-(4-(tert-Buto... CAS#:156478-71-6 |
| Literature: US5977139 A1, ; US 5977139 A |
|
~%
2-(4-(tert-Buto... CAS#:156478-71-6 |
| Literature: WO2013/53983 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Boc-1-piperazinyl)acetic acid |
| 2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)acetic acid |
| 2-(4-Boc-piperazino)acetic acid |
| [4-(tert-Butoxycarbonyl)piperazin-1-yl]acetic acid |