2-(2-Amino-5-bromobenzoyl)pyridine structure
|
Common Name | 2-(2-Amino-5-bromobenzoyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1563-56-0 | Molecular Weight | 277.117 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 451.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H9BrN2O | Melting Point | 98-100ºC | |
| MSDS | N/A | Flash Point | 226.7±27.3 °C | |
| Name | 2-(2-Amino-5-bromobenzoyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.2±40.0 °C at 760 mmHg |
| Melting Point | 98-100ºC |
| Molecular Formula | C12H9BrN2O |
| Molecular Weight | 277.117 |
| Flash Point | 226.7±27.3 °C |
| Exact Mass | 275.989807 |
| PSA | 55.98000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | KHVZPFKJBLTYCC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Br)cc1C(=O)c1ccccn1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~90%
2-(2-Amino-5-br... CAS#:1563-56-0 |
| Literature: CeNes Limited Patent: EP1183243 B1, 2006 ; Location in patent: Page/Page column 11 ; |
|
~58%
2-(2-Amino-5-br... CAS#:1563-56-0 |
| Literature: WISYS TECHNOLOGY FOUNDATION, INC. Patent: US2006/3995 A1, 2006 ; Location in patent: Page/Page column 60-61 ; |
|
~%
2-(2-Amino-5-br... CAS#:1563-56-0 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 35, # 10 p. 4338 - 4341 |
|
~%
2-(2-Amino-5-br... CAS#:1563-56-0 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 80, # 5 p. 459 - 468 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-amino-5-bromophenyl-2-pyridylmethanone |
| (2-Amino-5-bromophenyl)(pyridin-2-yl)methanone |
| (2-Amino-5-bromophenyl)(2-pyridinyl)methanone |
| Methanone, (2-amino-5-bromophenyl)-2-pyridinyl- |
| 2-(2-Amino-5-bromobenzoyl)pyridine |
| (2-amino-5-bromophenyl)-pyridin-2-ylmethanone |