Larotaxel structure
|
Common Name | Larotaxel | ||
|---|---|---|---|---|
| CAS Number | 156294-36-9 | Molecular Weight | 831.901 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 889.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H53NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 491.7±34.3 °C | |
Use of LarotaxelLarotaxel (XRP9881) is a taxane analogue with preclinical activity against taxane-resistant breast cancer. Larotaxel (XRP9881) exerts its cytotoxic effect by promoting tubulin assembly and stabilizing microtubules, ultimately leading to cell death by apoptosis. It presents the ability to cross the blood brain barrier and has a much lower affinity for P-glycoprotein 1 than Docetaxel[1][2][3]. |
| Name | (3ξ,5β,7β,10β)-4,10-Diacetoxy-1-hydroxy-13-{[(3S)-2-hydroxy-3-({[ (2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoyl]oxy}-9 -oxo-5,20-epoxy-7,19-cyclotax-11-en-2-yl benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Larotaxel (XRP9881) is a taxane analogue with preclinical activity against taxane-resistant breast cancer. Larotaxel (XRP9881) exerts its cytotoxic effect by promoting tubulin assembly and stabilizing microtubules, ultimately leading to cell death by apoptosis. It presents the ability to cross the blood brain barrier and has a much lower affinity for P-glycoprotein 1 than Docetaxel[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 889.3±65.0 °C at 760 mmHg |
| Molecular Formula | C45H53NO14 |
| Molecular Weight | 831.901 |
| Flash Point | 491.7±34.3 °C |
| Exact Mass | 831.346619 |
| PSA | 213.78000 |
| LogP | 7.06 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | DXOJIXGRFSHVKA-BZVZGCBYSA-N |
| SMILES | CC(=O)OC1C(=O)C23CC2CC2OCC2(OC(C)=O)C3C(OC(=O)c2ccccc2)C2(O)CC(OC(=O)C(O)C(NC(=O)OC(C)(C)C)c3ccccc3)C(C)=C1C2(C)C |
|
~%
Larotaxel CAS#:156294-36-9 |
| Literature: US2012/149925 A1, ; Page/Page column 17 ; |
|
~%
Larotaxel CAS#:156294-36-9 |
| Literature: US2012/149925 A1, ; |
|
~%
Larotaxel CAS#:156294-36-9 |
| Literature: US2012/149925 A1, ; |
|
~%
Larotaxel CAS#:156294-36-9 |
| Literature: US2012/149925 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| acetylcyclopropyl docetaxel |
| Valiolamine hydrate |
| Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-α-hydroxy-, (1S,2S,4S,7R,8aR,9aS,10aR,12aS,12bR)-7,12a-bis(acetyloxy)-1-(benzoyloxy)-1,3,4,7,8,9,9a,10,10a,12,12a,12b-dodecahydro- 2-hydroxy-5,13,13-trimethyl-8-oxo-2,6-methano-2H-cyclodeca[3,4]cyclopropa[4,5]benz[1,2-b]oxet-4-yl ester, (αR,βS)- |
| Valinolamine |
| valiolamine |
| acetocyclopropyl taxotere |
| (2α,5β,7β,10β,13α)-4,10-Diacetoxy-1-hydroxy-13-{[(2R,3S)-2-hydroxy-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoyl]oxy}-9-oxo-5,20-epoxy-7,19-cyclotax-11-en-2-yl benzo 
ate |