1-(tert-Butyl) 2-methyl 4-bromo-1H-pyrrole-1,2-dicarboxylate structure
|
Common Name | 1-(tert-Butyl) 2-methyl 4-bromo-1H-pyrrole-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 156237-78-4 | Molecular Weight | 304.137 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 349.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H14BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.3±28.7 °C | |
| Name | 1-O-tert-butyl 2-O-methyl 4-bromopyrrole-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.7±45.0 °C at 760 mmHg |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.137 |
| Flash Point | 165.3±28.7 °C |
| Exact Mass | 303.010620 |
| PSA | 57.53000 |
| LogP | 3.08 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | BLWTUIPDLAVPHI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)cn1C(=O)OC(C)(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 1-(tert-butoxycarbonyl)-4-bromopyrrole-2-carboxylate |
| RW3848 |
| 4-bromopyrrole-1,2-dicarboxylic acid 1-tertbutylester 2-methyl ester |
| methylbromopyrroledicarboxylate |
| 1-(tert-Butyl) 2-methyl 4-bromo-1H-pyrrole-1,2-dicarboxylate |
| 1H-Pyrrole-1,2-dicarboxylic acid, 4-bromo-, 1-(1,1-dimethylethyl) 2-methyl ester |
| 2-Methyl 1-(2-methyl-2-propanyl) 4-bromo-1H-pyrrole-1,2-dicarboxylate |