Isomagnolone
Modify Date: 2025-08-25 15:44:59
Isomagnolone structure
|
Common Name | Isomagnolone | ||
|---|---|---|---|---|
| CAS Number | 155709-41-4 | Molecular Weight | 282.334 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 414.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.9±22.2 °C | |
Use of IsomagnoloneIsomagnolone is isolated from Illicium burmanicum and has anti-inflammatory activity[1]. |
| Name | 1-[4-(5-Allyl-2-hydroxyphenoxy)phenyl]-1-propanone |
|---|---|
| Synonym | More Synonyms |
| Description | Isomagnolone is isolated from Illicium burmanicum and has anti-inflammatory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.4±45.0 °C at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.334 |
| Flash Point | 146.9±22.2 °C |
| Exact Mass | 282.125580 |
| PSA | 46.53000 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | LVHHYWFCRQIOJG-UHFFFAOYSA-N |
| SMILES | C=CCc1ccc(O)c(Oc2ccc(C(=O)CC)cc2)c1 |
| Hazard Codes | Xi |
|---|
| 1-Propanone, 1-[4-[2-hydroxy-5-(2-propen-1-yl)phenoxy]phenyl]- |
| 1-[4-(5-Allyl-2-hydroxyphenoxy)phenyl]-1-propanone |