Methyl 6-(trifluoromethyl)-2-pyridinecarboxylate structure
|
Common Name | Methyl 6-(trifluoromethyl)-2-pyridinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 155377-05-2 | Molecular Weight | 205.134 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 232.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.5±27.3 °C | |
| Name | Methyl 6-(trifluoromethyl)picolinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 232.6±40.0 °C at 760 mmHg |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.134 |
| Flash Point | 94.5±27.3 °C |
| Exact Mass | 205.035065 |
| PSA | 39.19000 |
| LogP | 1.96 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | AYABEJGGSWJVPN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(C(F)(F)F)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~96%
Methyl 6-(trifl... CAS#:155377-05-2 |
| Literature: ELI LILLY AND COMPANY Patent: WO2009/131814 A2, 2009 ; Location in patent: Page/Page column 45 ; WO 2009/131814 A2 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinecarboxylic acid, 6-(trifluoromethyl)-, methyl ester |
| Methyl 6-(trifluoromethyl)-2-pyridinecarboxylate |
| Methyl 6-(trifluoromethyl)pyridine-2-carboxylate |
| Enasidenib Intermediate 3 |