8-(3,5-difluorophenyl)-1,4-dioxaspiro(4,5)decan-8-ol structure
|
Common Name | 8-(3,5-difluorophenyl)-1,4-dioxaspiro(4,5)decan-8-ol | ||
|---|---|---|---|---|
| CAS Number | 155366-01-1 | Molecular Weight | 270.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(3,5-difluorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16F2O3 |
|---|---|
| Molecular Weight | 270.27200 |
| Exact Mass | 270.10700 |
| PSA | 38.69000 |
| LogP | 2.46950 |
| InChIKey | GKDZPKLOVXMPRR-UHFFFAOYSA-N |
| SMILES | OC1(c2cc(F)cc(F)c2)CCC2(CC1)OCCO2 |
|
~%
8-(3,5-difluoro... CAS#:155366-01-1 |
| Literature: Molecular Crystals and Liquid Crystals Science and Technology Section A: Molecular Crystals and Liquid Crystals, , vol. 364, p. 899 - 910 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Dioxaspiro[4.5]decan-8-ol,8-(3,5-difluorophenyl) |
| 8-(3,5-difluorophenyl)-1,4-dioxaspiro(4,5)decan-8-ol |