methyl (8S)-8-(bromomethyl)-2-methyl-4-(4-methylpiperazine-1-carbonyl)oxy-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate
![methyl (8S)-8-(bromomethyl)-2-methyl-4-(4-methylpiperazine-1-carbonyl)oxy-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate Structure](https://image.chemsrc.com/caspic/455/154889-68-6.png)
methyl (8S)-8-(bromomethyl)-2-methyl-4-(4-methylpiperazine-1-carbonyl)oxy-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate structure
|
Common Name | methyl (8S)-8-(bromomethyl)-2-methyl-4-(4-methylpiperazine-1-carbonyl)oxy-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 154889-68-6 | Molecular Weight | 698.56100 | |
| Density | 1.53g/cm3 | Boiling Point | 879.2ºC at 760 mmHg | |
| Molecular Formula | C32H36BrN5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 485.5ºC | |
| Name | methyl (8S)-8-(bromomethyl)-2-methyl-4-(4-methylpiperazine-1-carbonyl)oxy-6-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 879.2ºC at 760 mmHg |
| Molecular Formula | C32H36BrN5O8 |
| Molecular Weight | 698.56100 |
| Flash Point | 485.5ºC |
| Exact Mass | 697.17500 |
| PSA | 138.66000 |
| LogP | 4.59590 |
| Vapour Pressure | 1.93E-31mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | QRMNENFZDDYDEF-GOSISDBHSA-N |
| SMILES | COC(=O)c1c(C)[nH]c2c(OC(=O)N3CCN(C)CC3)cc3c(c12)C(CBr)CN3C(=O)c1cc2cc(OC)c(OC)c(OC)c2[nH]1 |
|
~%
methyl (8S)-8-(... CAS#:154889-68-6 |
| Literature: Fukuda, Yasumichi; Furuta, Hirosuke; Shiga, Futoshi; Asahina, Yoshikazu; Terashima, Shiro Heterocycles, 1997 , vol. 45, # 12 p. 2303 - 2308 |
|
~%
methyl (8S)-8-(... CAS#:154889-68-6 |
| Literature: Nagamura, Satoru; Kanda, Yutaka; Asai, Akira; Kobayashi, Eiji; Gomi, Katsushige; Saito, Hiromitsu Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 5 p. 933 - 939 |
|
~%
methyl (8S)-8-(... CAS#:154889-68-6 |
| Literature: Nagamura, Satoru; Saito, Hiromitsu Chemistry of Heterocyclic Compounds, 1998 , vol. 34, # 12 p. 1386 - 1405 |
|
~%
methyl (8S)-8-(... CAS#:154889-68-6 |
| Literature: Nagamura, Satoru; Saito, Hiromitsu Chemistry of Heterocyclic Compounds, 1998 , vol. 34, # 12 p. 1386 - 1405 |
|
~%
methyl (8S)-8-(... CAS#:154889-68-6 |
| Literature: Fukuda, Yasumichi; Furuta, Hirosuke; Shiga, Futoshi; Asahina, Yoshikazu; Terashima, Shiro Heterocycles, 1997 , vol. 45, # 12 p. 2303 - 2308 |
![methyl (1S,7R)-1-(bromomethyl)-7-methyl-5-[(4-methylpiperazinyl)carbonyloxy]-8-oxo-3-[(5,6,7-trimethoxy-2-indolyl)carbonyl]-1,2,7,8-tetrahydro-3H-pyrrolo[3,2-e]indole-7-carboxylate structure](https://image.chemsrc.com/caspic/043/154901-65-2.png)
| Methyl1,2,4,5-tetrahydro-3H-3-benzazepine-3-carboxylate |
| 1,2,4,5-tetrahydro-benzo[d]azepine-3-carboxylic acid methyl ester |
| methyl (1S)-1-(bromomethyl)-7-methyl-5-[(4-methylpiperazinyl)carbonyloxy]-3-[(5,6,7-trimethoxy-2-indolyl)-carbonyl]-1,2-dihydro-3H-pyrrolo[3,2-e]indole-8-carboxylate |
| 3-methoxycarbonyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| 3-Methoxycarbonyl-2,3,4,5-tetrahydro-1H-3-benzazepin |
| 3H-3-Benzazepine-3-carboxylicacid,1,2,4,5-tetrahydro-,methyl ester |
| 3-methoxycarbonyl-2-methyl-8-O-(4-methyl-1-piperazinylcarbonyl)duocarmycin B2 |