1-(4-chlorophenyl)-N-(4-ethoxyphenyl)methanimine structure
|
Common Name | 1-(4-chlorophenyl)-N-(4-ethoxyphenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 15484-92-1 | Molecular Weight | 259.73100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-N-(4-ethoxyphenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14ClNO |
|---|---|
| Molecular Weight | 259.73100 |
| Exact Mass | 259.07600 |
| PSA | 21.59000 |
| LogP | 4.48930 |
| InChIKey | VZUYGOJTZOHTOE-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N=Cc2ccc(Cl)cc2)cc1 |
|
~77%
1-(4-chlorophen... CAS#:15484-92-1 |
| Literature: Zhang, Erlei; Tian, Haiwen; Xu, Sendong; Yu, Xiaochun; Xu, Qing Organic Letters, 2013 , vol. 15, # 11 p. 2704 - 2707 |
|
~96%
1-(4-chlorophen... CAS#:15484-92-1 |
| Literature: Jarrahpour, Aliasghar; Fadavi, Abdolhamid; Zarei, Maaroof Bulletin of the Chemical Society of Japan, 2011 , vol. 84, # 3 p. 320 - 327 |
| (4-chlorobenzylidene)(4-ethoxyphenyl)amine |
| p-chlorobenzal-p'-phenitidine |
| p-chlorobenzylidene-(4-ethoxyphenyl)-amine |
| R2 = 4-EtOC6H4 |
| N-(4-chlorobenzylidene)-4-ethoxyaniline |
| Benzenamine,N-[(4-chlorophenyl)methylene]-4-ethoxy |
| N-(4-chlorobenzylidene)-4-ethoxyphenylamine |
| 4-Chlorbenzyliden-4'-ethoxyanilin |
| N-(4-chlorobenzylidene)-4-ethoxylaniline |