Iscotrizinol structure
|
Common Name | Iscotrizinol | ||
|---|---|---|---|---|
| CAS Number | 154702-15-5 | Molecular Weight | 765.983 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H59N7O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 2-ethylhexyl 4-[[4-[4-(tert-butylcarbamoyl)anilino]-6-[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C44H59N7O5 |
| Molecular Weight | 765.983 |
| Exact Mass | 765.457764 |
| PSA | 156.46000 |
| LogP | 11.89 |
| Index of Refraction | 1.590 |
| InChIKey | OSCJHTSDLYVCQC-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)c1ccc(Nc2nc(Nc3ccc(C(=O)NC(C)(C)C)cc3)nc(Nc3ccc(C(=O)OCC(CC)CCCC)cc3)n2)cc1 |
| Hazard Statements | H413 |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Iscotrizinol (USAN) |
| Bis(2-ethylhexyl) 4,4'-{[6-({4-[(2-methyl-2-propanyl)carbamoyl]phenyl}amino)-1,3,5-triazine-2,4-diyl]diimino}dibenzoate |
| ISCOTRIZINOL |
| Diethylhexyl butamido triazone |
| Uvasorb HEB (trade name) |
| Bis(2-ethylhexyl) 4,4'-[(6-{[4-(tert-butylcarbamoyl)phenyl]amino}-1,3,5-triazine-2,4-diyl)diimino]dibenzoate |
| Uvasorb HEB (3V Sigma) |
| Benzoic acid, 4,4'-[[6-[[4-[[(1,1-dimethylethyl)amino]carbonyl]phenyl]amino]- 1,3,5-triazine-2,4-diyl]diimino]bis-, bis(2-ethylhexyl) ester |
| DIETHYLHEXYL BUTAMIDO TRIAZONE (INCI) |
| UNII-2UTZ0QC864 |
| bis(2-ethylhexyl) 4,4'-[(6-{[4-(tert-butylcarbamoyl)phenyl]amino}-1,3,5- triazine-2,4-diyl)diimino]dibenzoate |
| Uvasorb HEB |
| Benzoic acid, 4,4'-[[6-[[4-[[(1,1-dimethylethyl)amino]carbonyl]phenyl]amino]-1,3,5-triazine-2,4-diyl]diimino]bis-, bis(2-ethylhexyl) ester |