Nickelate(2-),[7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-kN21,kN22,kN23,kN24]-, dihydrogen, (SP-4-2)-(9CI) structure
|
Common Name | Nickelate(2-),[7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-kN21,kN22,kN23,kN24]-, dihydrogen, (SP-4-2)-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 15415-30-2 | Molecular Weight | 619.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H32N4NiO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nickelate(2-),[7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-kN21,kN22,kN23,kN24]-, dihydrogen, (SP-4-2)-(9CI)Ni(II) protoporphyrin IX is a metalloporphyrin that has a low tendency toward axial ligation, becomes distorted when bound to ferrochelatase[1]. |
| Name | {dihydrogen-3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphineproprionato(2-)}Ni(II) |
|---|---|
| Synonym | More Synonyms |
| Description | Ni(II) protoporphyrin IX is a metalloporphyrin that has a low tendency toward axial ligation, becomes distorted when bound to ferrochelatase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C34H32N4NiO4 |
|---|---|
| Molecular Weight | 619.33600 |
| Exact Mass | 618.17800 |
| PSA | 94.32000 |
| LogP | 2.32480 |
| InChIKey | MIUBPTDRYUETHQ-QPPPNFCJSA-N |
| SMILES | C=Cc1c2[n-]c(c1C)C=c1[n-]c(c(C)c1C=C)=Cc1[n-]c(c(CCC(=O)O)c1C)C=c1[n-]c(c(C)c1CCC(=O)O)=C2.[Ni] |
| nickel(II) protoporphyrin IX |
| nickel protoporhyrin IX |
| nickel protoporphyrin IX |