Prunetrin
Modify Date: 2025-08-25 14:39:09
Prunetrin structure
|
Common Name | Prunetrin | ||
|---|---|---|---|---|
| CAS Number | 154-36-9 | Molecular Weight | 446.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PrunetrinPrunetin (Trifoside), an O-methylated isoflavone found in Prunus yedoensis, possesses anti-inflammatory activities[1][2]. |
| Name | 3-{4-[(2S,4S,5S,3R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)(2H-3,4,5,6-tetrahydropyran-2-yloxy)]phenyl}-5-hydroxy-7-methoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Prunetin (Trifoside), an O-methylated isoflavone found in Prunus yedoensis, possesses anti-inflammatory activities[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Prunetin inhibits LPS-induced nitric oxide and prostaglandin E2 production through the suppression of iNOS and COX-2 at the transcriptional level[1]. Prunetin inhibits lipopolysaccharide-induced inflammatory cytokine production and MUC5AC expression by inactivating the TLR4/MyD88 pathway in human nasal epithelial cells[2]. |
| References |
| Molecular Formula | C22H22O10 |
|---|---|
| Molecular Weight | 446.40400 |
| Exact Mass | 446.12100 |
| PSA | 159.05000 |
| LogP | 0.35290 |
| InChIKey | OFUWGCQDMVDLIR-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c(-c3ccc(OC4OC(CO)C(O)C(O)C4O)cc3)coc2c1 |
| 3-(4-β-D-glucopyranosyloxy-phenyl)-5-hydroxy-7-methoxy-chromen-4-one |
| 5-Hydroxy-7-methoxy-3-[4-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxy)-phenyl]-chromen-4-one |
| prunetin-4'-O-β-D glucopyranoside |
| prunetrin |
| Prunetin 4'-O-β-D-glucopyranoside |
| prunetin 4'-O-[β-D-glucopyranoside] |
| 4',5-dihydroxy-7-methoxyisoflavone-4'-O-β-D-glucopyranoside |