methyl 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate structure
|
Common Name | methyl 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 153559-48-9 | Molecular Weight | 362.50500 | |
| Density | 1.007g/cm3 | Boiling Point | 472.3ºC at 760 mmHg | |
| Molecular Formula | C25H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | methyl 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.007g/cm3 |
|---|---|
| Boiling Point | 472.3ºC at 760 mmHg |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.50500 |
| Flash Point | 173.2ºC |
| Exact Mass | 362.22500 |
| PSA | 26.30000 |
| LogP | 6.19210 |
| Vapour Pressure | 4.32E-09mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | VSMOGQLTPWIBNI-UHFFFAOYSA-N |
| SMILES | C=C(c1ccc(C(=O)OC)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| bexarotene methyl ester |