7-Epi-docetaxel structure
|
Common Name | 7-Epi-docetaxel | ||
|---|---|---|---|---|
| CAS Number | 153381-68-1 | Molecular Weight | 807.87900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H53NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 7-Epi-docetaxel7-Epi-10-oxo-docetaxel (Docetaxel Impurity C; 7-Epitaxotere) is a impurity of docetaxel. |
| Name | 7-epi-docetaxel |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Epi-10-oxo-docetaxel (Docetaxel Impurity C; 7-Epitaxotere) is a impurity of docetaxel. |
|---|---|
| Related Catalog |
| Molecular Formula | C43H53NO14 |
|---|---|
| Molecular Weight | 807.87900 |
| Exact Mass | 807.34700 |
| PSA | 227.94000 |
| LogP | 3.46400 |
| InChIKey | ZDZOTLJHXYCWBA-MQOKZWAMSA-N |
| SMILES | CC(=O)OC12COC1CC(O)C1(C)C(=O)C(O)C3=C(C)C(OC(=O)C(O)C(NC(=O)OC(C)(C)C)c4ccccc4)CC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C |
| Storage condition | 2-8℃ |
|
~42%
7-Epi-docetaxel CAS#:153381-68-1 |
| Literature: SAMYANG GENEX CORPORATION Patent: US2009/18353 A1, 2009 ; Location in patent: Page/Page column 6 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2b,5b,7a,10b,13a)-4-Acetoxy-13-(((2R,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-3-phenylpropanoyl)oxy)-1,7,10-trihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl Benzoate |
| 7-Epitaxotere |
| 7-Epidocetaxel |