Amyloid β-Protein (16-22) trifluoroacetate salt structure
|
Common Name | Amyloid β-Protein (16-22) trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 153247-41-7 | Molecular Weight | 853.02 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 1219.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C43H64N8O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 691.6±34.3 °C | |
Use of Amyloid β-Protein (16-22) trifluoroacetate saltAmyloid β-Protein (16-22) is aAβ Fragment. |
| Name | Amyloid β-Protein (16-22) trifluoroacetate salt |
|---|---|
| Synonym | More Synonyms |
| Description | Amyloid β-Protein (16-22) is aAβ Fragment. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 1219.9±65.0 °C at 760 mmHg |
| Molecular Formula | C43H64N8O10 |
| Molecular Weight | 853.02 |
| Flash Point | 691.6±34.3 °C |
| Exact Mass | 852.474548 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | WMQMXRMQUXWHCC-YJVMEOIXSA-N |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)NC(C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)O)C(C)C.O=C(O)C(F)(F)F |
| L-Glutamic acid, L-lysyl-L-leucyl-L-valyl-L-phenylalanyl-L-phenylalanyl-L-alanyl- |
| L-Lysyl-L-leucyl-L-valyl-L-phenylalanyl-L-phenylalanyl-L-alanyl-L-glutamic acid |