etoxazole structure
|
Common Name | etoxazole | ||
|---|---|---|---|---|
| CAS Number | 153233-91-1 | Molecular Weight | 359.41 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 449.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H23F2NO2 | Melting Point | 101-102ºC | |
| MSDS | Chinese USA | Flash Point | 225.4±28.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of etoxazoleEtoxazole (YI-5301) is an organofluorine insecticide widely used in agriculture. Etoxazole affects the nymphs, eggs, and larvae of spider mites by inhibiting chitin biosynthesis[1]. |
| Name | etoxazole |
|---|---|
| Synonym | More Synonyms |
| Description | Etoxazole (YI-5301) is an organofluorine insecticide widely used in agriculture. Etoxazole affects the nymphs, eggs, and larvae of spider mites by inhibiting chitin biosynthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.1±45.0 °C at 760 mmHg |
| Melting Point | 101-102ºC |
| Molecular Formula | C21H23F2NO2 |
| Molecular Weight | 359.41 |
| Flash Point | 225.4±28.7 °C |
| Exact Mass | 359.169678 |
| PSA | 30.82000 |
| LogP | 5.85 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | IXSZQYVWNJNRAL-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C(C)(C)C)ccc1C1COC(c2c(F)cccc2F)=N1 |
| Storage condition | 0-6°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H332-H410 |
| Precautionary Statements | P261-P273-P304 + P340 + P312-P391-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | N |
| Risk Phrases | R50/53 |
| Safety Phrases | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| RTECS | RP6795100 |
| 5-tert-Butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole |
| 4-(4-tert-Butyl-2-ethoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| Oxazole, 2-(2,6-difluorophenyl)-4-[4-(1,1-dimethylethyl)-2-ethoxyphenyl]-4,5-dihydro- |
| (RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole |
| 4-(4-(tert-Butyl)-2-ethoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydrooxazole |
| 2-(2,6-Difluorophenyl)-4-(4-(1,1-dimethylethyl)-2-ethoxyphenyl)-4,5-dihydrooxazole |
| 2-(2,6-difluorophenyl)-4-[4-(1,1-dimethylethyl)-2-ethoxyphenyl]-4,5-dihydrooxazole |
| etoxazole |
| rac-(4R)-2-(2,6-difluorophenyl)-4-(4-tert-butyl-2-ethoxyphenyl)-4,5-dihydro-1,3-oxazole |
| T5N CO AUTJ BR BF FF& ER BO2 DX1&1&1 |
| 2-(2,6-Difluorophenyl)-4-[2-ethoxy-4-(2-methyl-2-propanyl)phenyl]-4,5-dihydro-1,3-oxazole |