2,5-bis(hexyloxy)terephthalaldehyde
Modify Date: 2025-08-21 11:50:11
2,5-bis(hexyloxy)terephthalaldehyde structure
|
Common Name | 2,5-bis(hexyloxy)terephthalaldehyde | ||
|---|---|---|---|---|
| CAS Number | 151903-52-5 | Molecular Weight | 334.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O4 | Melting Point | 75.0-77.2ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-dihexoxyterephthalaldehyde |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 75.0-77.2ºC(lit.) |
|---|---|
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45000 |
| Exact Mass | 334.21400 |
| PSA | 52.60000 |
| LogP | 5.22980 |
| InChIKey | QNZNMVAGYIDUKL-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1cc(C=O)c(OCCCCCC)cc1C=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2912499000 |
|
~50%
2,5-bis(hexylox... CAS#:151903-52-5 |
| Literature: Sarker, Ananda M.; Ding, Liming; Lahti, Paul M.; Karasz, Frank E. Macromolecules, 2002 , vol. 35, # 1 p. 223 - 230 |
|
~5%
2,5-bis(hexylox... CAS#:151903-52-5 |
| Literature: Meier, Herbert; Lehmann, Matthias; Holst, Hans Christof; Schwoeppe, Dirk Tetrahedron, 2004 , vol. 60, # 32 p. 6881 - 6888 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,4-diformyl-2,5-dihexyloxybenzene |
| MFCD03427236 |
| 2,5-bis(hexyloxy)terephthalaldehyde |
| 2,5-dihexyloxybenzene-1,4-dicarbaldehyde |
| 2,5-Dihexyloxy-1,4-benzenedicarboxaldehyde |
| 1,4-bis(hexyloxy)benzene-2,5-dicarbaldehyde |
| 1,4-Benzenedicarboxaldehyde,2,5-bis(hexyloxy) |
| 2,5-bis(hexyloxy)-benzene-1,4-dialdehyde |