6-Bromo-2-naphthyl Trifluoromethanesulfonate structure
|
Common Name | 6-Bromo-2-naphthyl Trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 151600-02-1 | Molecular Weight | 355.12800 | |
| Density | 1.765g/cm3 | Boiling Point | 394ºC at 760 mmHg | |
| Molecular Formula | C11H6BrF3O3S | Melting Point | 54ºC | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | (6-bromonaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.765g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760 mmHg |
| Melting Point | 54ºC |
| Molecular Formula | C11H6BrF3O3S |
| Molecular Weight | 355.12800 |
| Flash Point | 192.1ºC |
| Exact Mass | 353.91700 |
| PSA | 51.75000 |
| LogP | 4.91150 |
| Vapour Pressure | 4.65E-06mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FRNRXKFDZXFNKG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccc2cc(Br)ccc2c1)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2906299090 |
|
~97%
6-Bromo-2-napht... CAS#:151600-02-1 |
| Literature: Sony Corporation; Ichimura, Mari; Miyabayashi, Yoshihisa Patent: US8357821 B2, 2013 ; Location in patent: Page/Page column 49 ; |
|
~10%
6-Bromo-2-napht... CAS#:151600-02-1 |
| Literature: Tam, Victor K.; Liu, Qi; Tor, Yitzhak Chemical Communications, 2006 , # 25 p. 2684 - 2686 |
|
~%
6-Bromo-2-napht... CAS#:151600-02-1 |
| Literature: Journal of Organic Chemistry, , vol. 76, # 15 p. 6367 - 6371 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 6-Bromo-2-naphthyl Triflate |
| 6-bromo-2-naphthalenyl trifluoromethanesulphonate |
| 6-bromo-2-naphthalenyl trifluoromethanesulfonate |
| trifluoromethanesulfonic acid 6-bromonaphthalen-2-yl ester |
| PC2463 |
| 6-bromonaphthalen-2-yl trifluoromethanesulfonate |
| Trifluoromethanesulfonic Acid 6-Bromo-2-naphthyl Ester |
| 6-BroMo-2-naphthyl TrifluoroMethanesulfonate |
| 6-Bromo-2-naphthyl Trifluoromethanesulfonate |
| 2-Trifluoromethanesulfonyloxy-6-bromonaphthalene |