dimethyl hexafluoroglutarate structure
|
Common Name | dimethyl hexafluoroglutarate | ||
|---|---|---|---|---|
| CAS Number | 1513-62-8 | Molecular Weight | 268.11100 | |
| Density | 1.486 g/mL at 25 °C(lit.) | Boiling Point | 100 °C34 mm Hg(lit.) | |
| Molecular Formula | C7H6F6O4 | Melting Point | −31.8 °C(lit.) | |
| MSDS | N/A | Flash Point | 200 °F | |
| Name | dimethyl 2,2,3,3,4,4-hexafluoropentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 100 °C34 mm Hg(lit.) |
| Melting Point | −31.8 °C(lit.) |
| Molecular Formula | C7H6F6O4 |
| Molecular Weight | 268.11100 |
| Flash Point | 200 °F |
| Exact Mass | 268.01700 |
| PSA | 52.60000 |
| LogP | 1.23830 |
| Vapour Pressure | 0.838mmHg at 25°C |
| Index of Refraction | n20/D 1.352(lit.) |
| InChIKey | PJZVBCPDYSZAJU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2917190090 |
|
~85%
dimethyl hexafl... CAS#:1513-62-8 |
| Literature: Hu, Chang-Ming; Long, Fei; Xu, Ze-Qi Journal of Fluorine Chemistry, 1990 , vol. 48, # 1 p. 29 - 35 |
|
~%
dimethyl hexafl... CAS#:1513-62-8 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 36, p. 862 - 871,878 - 885 |
|
~%
dimethyl hexafl... CAS#:1513-62-8 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 36, p. 862 - 871,878 - 885 |
|
~%
dimethyl hexafl... CAS#:1513-62-8 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 36, p. 1330 - 1337,1344 - 1350 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Dimethyl hexafluoroglutarate |
| Dimethyl perfluorglutarat |
| Perfluoroglutarsaeure dimethylester |
| Dimethyl Perfluoroglutarate |
| Perfluoroglutaric Acid Dimethyl Ester |
| Hexafluor-glutarsaeure-dimethylester |
| Dimethyl Hexafluoropentanedioate |
| Hexafluoroglutaric acid dimethyl ester |
| HFGDE |
| Hexafluoropentanedioic Acid Dimethyl Ester |
| MFCD00155851 |