ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate structure
|
Common Name | ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate | ||
|---|---|---|---|---|
| CAS Number | 1513-60-6 | Molecular Weight | 236.11200 | |
| Density | >1.1 | Boiling Point | 128 °C | |
| Molecular Formula | C7H6F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 43°C | |
| Name | ethyl 4,4,4-trifluoro-3-(trifluoromethyl)but-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | >1.1 |
|---|---|
| Boiling Point | 128 °C |
| Molecular Formula | C7H6F6O2 |
| Molecular Weight | 236.11200 |
| Flash Point | 43°C |
| Exact Mass | 236.02700 |
| PSA | 26.30000 |
| LogP | 2.60050 |
| Vapour Pressure | 5.69mmHg at 25°C |
| Index of Refraction | 1.341 |
| InChIKey | CULZFNOUPBWSIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(C(F)(F)F)C(F)(F)F |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | R10 |
| Safety Phrases | S16-S26-S36 |
| RIDADR | 3272 |
| HS Code | 2916190090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| MFCD00041517 |
| PC3289G |
| 4,4,4-Trifluor-3-trifluormethylcrotonsaeure-ethylester |
| ethyl 4,4,4-trifluoro-3-trifluoromethyl-2-butenoate |