2-nitro-4-trifluoromethylphenylhydrazine structure
|
Common Name | 2-nitro-4-trifluoromethylphenylhydrazine | ||
|---|---|---|---|---|
| CAS Number | 1513-50-4 | Molecular Weight | 221.137 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 278.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H6F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.9±27.3 °C | |
| Name | [2-nitro-4-(trifluoromethyl)phenyl]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.0±40.0 °C at 760 mmHg |
| Molecular Formula | C7H6F3N3O2 |
| Molecular Weight | 221.137 |
| Flash Point | 121.9±27.3 °C |
| Exact Mass | 221.041214 |
| PSA | 83.87000 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | WJBJSMUUWDXKBR-UHFFFAOYSA-N |
| SMILES | NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2928000090 |
|
~72%
2-nitro-4-trifl... CAS#:1513-50-4 |
| Literature: Lindley, John M.; McRobbie, Ian M.; Meth-Cohn, Otto; Suschitzky, Hans Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 982 - 994 |
|
~%
2-nitro-4-trifl... CAS#:1513-50-4 |
| Literature: Farmaco (Societa chimica italiana : 1989), , vol. 44, # 3 p. 279 - 301 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (2-Nitro-4-trifluoromethyl-phenyl)-hydrazine |
| Hydrazine, 4-trifluoromethyl-2-nitrophenyl- |
| 2-Nitro-4-trifluoromethylphenylhydrazin |
| 4-trifluoromethyl-2-nitrophenylhydrazine |
| 4-hydrazino-3-nitrobenzotrifluoride |
| MFCD00622442 |
| [2-Nitro-4-(trifluoromethyl)phenyl]hydrazine |
| 2-nitro-4-trifluoromethylphenylhydrazine |
| Hydrazine, [2-nitro-4-(trifluoromethyl)phenyl]- |