1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid structure
|
Common Name | 1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1511861-89-4 | Molecular Weight | 228.65 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 333.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H10ClFO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.2±27.9 °C | |
| Name | 2-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid, Mixture of diastereomers |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.0±42.0 °C at 760 mmHg |
| Molecular Formula | C11H10ClFO2 |
| Molecular Weight | 228.65 |
| Flash Point | 155.2±27.9 °C |
| Exact Mass | 228.035339 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | RUSMVFLKTIIRDG-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCC1c1ccc(Cl)cc1F |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| MFCD24024532 |
| Cyclobutanecarboxylic acid, 2-(4-chloro-2-fluorophenyl)- |
| 2-(4-Chloro-2-fluorophenyl)cyclobutanecarboxylic acid |