dibromoisocyanuricacid structure
|
Common Name | dibromoisocyanuricacid | ||
|---|---|---|---|---|
| CAS Number | 15114-43-9 | Molecular Weight | 286.866 | |
| Density | 2.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C3HBr2N3O3 | Melting Point | 309ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS03, GHS05, GHS07 |
Signal Word | Danger | |
| Name | 1,3-dibromo-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.8±0.1 g/cm3 |
|---|---|
| Melting Point | 309ºC |
| Molecular Formula | C3HBr2N3O3 |
| Molecular Weight | 286.866 |
| Exact Mass | 284.838440 |
| PSA | 76.86000 |
| LogP | -0.33 |
| Index of Refraction | 1.712 |
| InChIKey | HHBCEKAWSILOOP-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(Br)c(=O)n1Br |
| Storage condition | 2~8°C |
| Symbol |
GHS03, GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H272-H302-H314 |
| Supplemental HS | Contact with acids liberates toxic gas. |
| Precautionary Statements | P220-P280-P305 + P351 + P338-P310 |
| Hazard Codes | C |
| RIDADR | UN 3085 5.1/PG 2 |
| HS Code | 2933699090 |
|
~%
dibromoisocyanu... CAS#:15114-43-9 |
| Literature: Organic Letters, , vol. 2, # 15 p. 2221 - 2223 |
|
~%
dibromoisocyanu... CAS#:15114-43-9 |
| Literature: Monatshefte fuer Chemie, , vol. 98, # 2 p. 507 C: MVol.D1, 39.8.4, page 380 - 380 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| MFCD00463941 |
| 1,3-Dibromo-1,3,5-triazinane-2,4,6-trione |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dibromo- |
| dibromoisocyanuricacid |
| dibromisocyanurate |
| dibromoisocyanurate |
| dibromocyanuric acid |
| DibroMoisocyanuric Acid |
| N,N'-dibromoisocyanuric acid |
| 1,3-Dibromo-1,3,5-triazine-2,4,6-trione |