2(1H)-Quinoxalinone,3-phenyl- structure
|
Common Name | 2(1H)-Quinoxalinone,3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1504-78-5 | Molecular Weight | 222.24200 | |
| Density | 1.24g/cm3 | Boiling Point | 426.2ºC at 760mmHg | |
| Molecular Formula | C14H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.5ºC | |
| Name | 3-phenyl-1H-quinoxalin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 426.2ºC at 760mmHg |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.24200 |
| Flash Point | 211.5ºC |
| Exact Mass | 222.07900 |
| PSA | 45.75000 |
| LogP | 2.59010 |
| Vapour Pressure | 7.28E-08mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | ZBBQSGVRBQKLLE-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccccc2nc1-c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-phenylquinoxalin-2-ol |
| 3-phenylquinoxalin-2-one |
| 3-phenylhydroquinoxalin-2-one |
| F1492-0018 |
| 3-Phenyl-2-quinoxalone |