4-(Chlorosulfonyl)phenyl pivalate structure
|
Common Name | 4-(Chlorosulfonyl)phenyl pivalate | ||
|---|---|---|---|---|
| CAS Number | 150374-99-5 | Molecular Weight | 276.737 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H13ClO4S | Melting Point | 83-87ºC | |
| MSDS | N/A | Flash Point | 168.9±23.2 °C | |
| Name | 4-Chlorosulfonylphenylpivalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.6±25.0 °C at 760 mmHg |
| Melting Point | 83-87ºC |
| Molecular Formula | C11H13ClO4S |
| Molecular Weight | 276.737 |
| Flash Point | 168.9±23.2 °C |
| Exact Mass | 276.022308 |
| PSA | 68.82000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | BSRSTUAZWZWGRT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Oc1ccc(S(=O)(=O)Cl)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2915900090 |
|
~%
4-(Chlorosulfon... CAS#:150374-99-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 4, # 12 p. 2115 - 2134 |
|
~%
4-(Chlorosulfon... CAS#:150374-99-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 4, # 12 p. 2115 - 2134 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 4-(Chlorosulfonyl)phenyl pivalate |
| Propanoic acid, 2,2-dimethyl-, 4-(chlorosulfonyl)phenyl ester |
| (4-chlorosulfonylphenyl) 2,2-dimethylpropanoate |