PD-85639
Modify Date: 2025-09-12 16:28:30
PD-85639 structure
|
Common Name | PD-85639 | ||
|---|---|---|---|---|
| CAS Number | 150034-24-5 | Molecular Weight | 364.5 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 548.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.4±30.1 °C | |
| Name | PD-85639 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 548.4±50.0 °C at 760 mmHg |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.5 |
| Flash Point | 285.4±30.1 °C |
| Exact Mass | 364.251465 |
| LogP | 4.70 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | BPZBEIHSHWNWTE-UHFFFAOYSA-N |
| SMILES | CC1CCCC(C)N1CCCNC(=O)C(c1ccccc1)c1ccccc1 |
| Water Solubility | Soluble in DMSO (6.5 mg/ml; 25 mg/ml in anhydrous DMSO) and ethanol (0.6 mg/ml) |
| PD85639 |
| N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2,2-diphenylacetamide |
| PD85,639 |
| MFCD14635427 |
| N-[3-(2,6-Dimethyl-1-piperidinyl)propyl]-2,2-diphenylacetamide |
| N-[3-(2,6-Dimethyl-1-piperidinyl)propyl]-α-phenylbenzeneacetamide |
| Benzeneacetamide, N-[3-(2,6-dimethyl-1-piperidinyl)propyl]-α-phenyl- |