Spiro[2H-1-benzopyran-2,2'-[2H]indole],1',3'-dihydro-8-methoxy-1',3',3'-trimethyl-6-nitro- structure
|
Common Name | Spiro[2H-1-benzopyran-2,2'-[2H]indole],1',3'-dihydro-8-methoxy-1',3',3'-trimethyl-6-nitro- | ||
|---|---|---|---|---|
| CAS Number | 1498-89-1 | Molecular Weight | 352.38400 | |
| Density | 1.32g/cm3 | Boiling Point | 513.6ºC at 760mmHg | |
| Molecular Formula | C20H20N2O4 | Melting Point | 159-162ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 264.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 8-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 513.6ºC at 760mmHg |
| Melting Point | 159-162ºC(lit.) |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.38400 |
| Flash Point | 264.4ºC |
| Exact Mass | 352.14200 |
| PSA | 67.52000 |
| LogP | 4.72110 |
| Vapour Pressure | 1.17E-10mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | IZDVWQPIYXTGIF-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(C)c2ccccc2C1(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Methoxy-1',3',3'-trimethyl-6-nitro-spiro[chromen-2,2'-indolin] |
| Spiro[2H-1-benzopyran-2,2'-indoline],8-methoxy-1',3',3'-trimethyl-6-nitro |
| 8-methoxy-1',3',3'-trimethyl-6-nitro-spiro[chromene-2,2'-indoline] |
| 1',3'-dihydro-8-methoxy-1',3',3'-trimethyl-6-nitrospiro[2H-1-benzopyran-2,2'-(2H)-indole] |
| 8-methoxy-1',3',3'-trimethyl-6-nitro-1',3'-dihydrospiro[chromene-2,2'-indole] |
| MFCD00216608 |
| 1',3',3'-trimethyl-6-nitro-8-methoxyspiro-{2H-1}-benzopyran-2,2'-(2H)indole |
| EINECS 216-103-0 |