N,S-Bis-Fmoc-glutathione structure
|
Common Name | N,S-Bis-Fmoc-glutathione | ||
|---|---|---|---|---|
| CAS Number | 149438-56-2 | Molecular Weight | 751.80 | |
| Density | 1.392g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C40H37N3O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N,S-Bis-Fmoc-glutathioneN,S-Bis-Fmoc-Glutathione is a potent glyoxalase II inhibitor with a Ki value of 0.32 mM[1]. |
| Name | n,s-bis-fmoc-glutathione |
|---|
| Description | N,S-Bis-Fmoc-Glutathione is a potent glyoxalase II inhibitor with a Ki value of 0.32 mM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.392g/cm3 |
|---|---|
| Molecular Formula | C40H37N3O10S |
| Molecular Weight | 751.80 |
| Exact Mass | 751.22000 |
| PSA | 222.73000 |
| LogP | 6.29910 |
| InChIKey | RASUYODSPFXBSK-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(CSC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC(=O)O |
| Storage condition | -15°C |