3-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)ACRYLIC ACID structure
|
Common Name | 3-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)ACRYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 14939-91-4 | Molecular Weight | 206.195 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 377.0±21.0 °C at 760 mmHg | |
| Molecular Formula | C11H10O4 | Melting Point | 196-198ºC | |
| MSDS | N/A | Flash Point | 151.6±15.6 °C | |
| Name | 3-(2,3-Dihydro-1,4-benzodioxin-6-yl)acrylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.0±21.0 °C at 760 mmHg |
| Melting Point | 196-198ºC |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.195 |
| Flash Point | 151.6±15.6 °C |
| Exact Mass | 206.057907 |
| PSA | 55.76000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | KPDOZWMLNDDCDJ-DUXPYHPUSA-N |
| SMILES | O=C(O)C=Cc1ccc2c(c1)OCCO2 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2932999099 |
|
~%
3-(2,3-DIHYDRO-... CAS#:14939-91-4 |
| Literature: EP855387 A1, ; |
|
~%
3-(2,3-DIHYDRO-... CAS#:14939-91-4 |
| Literature: Zhurnal Organicheskoi Khimii, , vol. 3, p. 921,925; engl. Ausg. S. 886, 889 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Propenoic acid, 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-, (2E)- |
| (2E)-3-(2,3-Dihydro-1,4-benzodioxin-6-yl)acrylic acid |
| 3-(2,3-dihydro-1,4-benzodioxin-6-yl)acrylic acid |