1-Dehydroxy-23-deoxojessic acid structure
|
Common Name | 1-Dehydroxy-23-deoxojessic acid | ||
|---|---|---|---|---|
| CAS Number | 149252-87-9 | Molecular Weight | 470.727 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 574.2±33.0 °C at 760 mmHg | |
| Molecular Formula | C31H50O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.1±21.9 °C | |
Use of 1-Dehydroxy-23-deoxojessic acid1-Dehydroxy-23-deoxojessic acid (compound 10) is a cycloartane-type triterpene. 1-Dehydroxy-23-deoxojessic acid exhibits cytotoxicity against murine colon 26-L5 carcinoma cells, with an EC50 of 62.38 μM[1]. |
| Name | cpd-12867 |
|---|---|
| Synonym | More Synonyms |
| Description | 1-Dehydroxy-23-deoxojessic acid (compound 10) is a cycloartane-type triterpene. 1-Dehydroxy-23-deoxojessic acid exhibits cytotoxicity against murine colon 26-L5 carcinoma cells, with an EC50 of 62.38 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 574.2±33.0 °C at 760 mmHg |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.727 |
| Flash Point | 315.1±21.9 °C |
| Exact Mass | 470.376007 |
| PSA | 57.53000 |
| LogP | 9.45 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | RLRGKMMFFVWPHT-UHFFFAOYSA-N |
| SMILES | C=C(CCC(C)C1CCC2(C)C3CCC4C(C)(C(=O)O)C(O)CCC45CC35CCC12C)C(C)C |
| Hazard Codes | Xi |
|---|
| 9,19-Cyclolanostan-28-oic acid, 3-hydroxy-24-methylene-, (3β,9β)- |
| (3β,9β)-3-hydroxy-24-methylidene-9,19-cyclolanostan-28-oic acid |
| (3β,9β)-3-Hydroxy-24-methylene-9,19-cyclolanostan-28-oic acid |