Butacaine structure
|
Common Name | Butacaine | ||
|---|---|---|---|---|
| CAS Number | 149-16-6 | Molecular Weight | 306.44300 | |
| Density | 1.014g/cm3 | Boiling Point | 440ºC at 760 mmHg | |
| Molecular Formula | C18H30N2O2 | Melting Point | 25°C | |
| MSDS | N/A | Flash Point | 219.9ºC | |
Use of ButacaineButacaine is a local anesthetic. |
| Name | 3-(dibutylamino)propyl 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Butacaine is a local anesthetic. |
|---|---|
| Related Catalog |
| Density | 1.014g/cm3 |
|---|---|
| Boiling Point | 440ºC at 760 mmHg |
| Melting Point | 25°C |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.44300 |
| Flash Point | 219.9ºC |
| Exact Mass | 306.23100 |
| PSA | 55.56000 |
| LogP | 4.29910 |
| Vapour Pressure | 6.1E-08mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | HQFWVSGBVLEQGA-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCCOC(=O)c1ccc(N)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| RIDADR | UN 3249 |
|---|---|
| WGK Germany | 3 |
| RTECS | UB0875000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2922499990 |
|
~%
Butacaine CAS#:149-16-6 |
| Literature: Abbott Laboratories Patent: GB191122 ; |
|
~%
Butacaine CAS#:149-16-6 |
| Literature: Abbott Laboratories Patent: GB191122 ; Full Text Show Details Adams; Volwiler; Abbott Laboratories Patent: US1676470 ; |
|
~%
Butacaine CAS#:149-16-6 |
| Literature: Kamm; Adams; Volwiler; Abbott Laboratories Patent: US1358751 ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| p-Aminobenzoyldibutylaminopropanol |
| EINECS 205-734-7 |
| butacaine |
| 3-Dibutylaminopropyl p-aminobenzoate |
| MFCD00056117 |
| <3-Dibutylaminopropyl>-4-amino-benzoat |