5-chloro-3-phenylthioindole-2-carboxamide structure
|
Common Name | 5-chloro-3-phenylthioindole-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 148473-16-9 | Molecular Weight | 302.77900 | |
| Density | 1.47g/cm3 | Boiling Point | 556.7ºC at 760mmHg | |
| Molecular Formula | C15H11ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.5ºC | |
| Name | 5-chloro-3-phenylsulfanyl-1H-indole-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 556.7ºC at 760mmHg |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.77900 |
| Flash Point | 290.5ºC |
| Exact Mass | 302.02800 |
| PSA | 85.17000 |
| LogP | 4.95560 |
| Vapour Pressure | 1.99E-12mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | SEAXPFZOFZLHLQ-UHFFFAOYSA-N |
| SMILES | NC(=O)c1[nH]c2ccc(Cl)cc2c1Sc1ccccc1 |
|
~%
5-chloro-3-phen... CAS#:148473-16-9 |
| Literature: Williams; Ciccarone; MacTough; Rooney; Balani; Condra; Emini; Goldman; Greenlee; Kauffman; O'Brien; Sardana; Schleif; Theoharides; Anderson Journal of Medicinal Chemistry, 1993 , vol. 36, # 9 p. 1291 - 1294 |
|
~%
5-chloro-3-phen... CAS#:148473-16-9 |
| Literature: Williams; Ciccarone; MacTough; Rooney; Balani; Condra; Emini; Goldman; Greenlee; Kauffman; O'Brien; Sardana; Schleif; Theoharides; Anderson Journal of Medicinal Chemistry, 1993 , vol. 36, # 9 p. 1291 - 1294 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-chloro-3-phenylthioindole-2-carboxamide |
| 5Cl3PhS-2IndolCONH2 |