2,2':6',2''-TERPYRIDINE]-4'-CARBOXYLIC ACID structure
|
Common Name | 2,2':6',2''-TERPYRIDINE]-4'-CARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 148332-36-9 | Molecular Weight | 277.27700 | |
| Density | 1.306g/cm3 | Boiling Point | 582.6ºC at 760 mmHg | |
| Molecular Formula | C16H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.2ºC | |
| Name | 2,6-dipyridin-2-ylpyridine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 582.6ºC at 760 mmHg |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.27700 |
| Flash Point | 306.2ºC |
| Exact Mass | 277.08500 |
| PSA | 75.97000 |
| LogP | 2.90380 |
| Vapour Pressure | 2.04E-14mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | ZYTWXMBGOUJDHJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4'-carboxyl-2,2':6',2''-terpyridine |
| 4'-carboxy-2,2':6',2''-terpyridine |
| [2,2':6',2''-Terpyridine]-4'-carboxylic acid |
| 2,2':6',2''-terpyridine carboxylic acid |