2-(2'-carboxyphenyl)benzoyl-6-aminopenicillanic acid
Modify Date: 2025-08-25 19:12:27
2-(2'-carboxyphenyl)benzoyl-6-aminopenicillanic acid structure
|
Common Name | 2-(2'-carboxyphenyl)benzoyl-6-aminopenicillanic acid | ||
|---|---|---|---|---|
| CAS Number | 14796-35-1 | Molecular Weight | 440.46900 | |
| Density | 1.53g/cm3 | Boiling Point | 752.7ºC at 760mmHg | |
| Molecular Formula | C22H20N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409ºC | |
| Name | (2S,5R,6R)-6-[[2-(2-carboxyphenyl)benzoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 752.7ºC at 760mmHg |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.46900 |
| Flash Point | 409ºC |
| Exact Mass | 440.10400 |
| PSA | 152.80000 |
| LogP | 2.80980 |
| Vapour Pressure | 8.32E-24mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | WBCAUHBSTJESRM-JTDSTZFVSA-N |
| SMILES | CC1(C)SC2C(NC(=O)c3ccccc3-c3ccccc3C(=O)O)C(=O)N2C1C(=O)O |
|
~%
2-(2'-carboxyph... CAS#:14796-35-1 |
| Literature: Perron,Y.G. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 3365 - 3367 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Cbapa |