Tyclopyrazoflor
Modify Date: 2025-08-25 15:22:11
Tyclopyrazoflor structure
|
Common Name | Tyclopyrazoflor | ||
|---|---|---|---|---|
| CAS Number | 1477919-27-9 | Molecular Weight | 406.85 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18ClF3N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TyclopyrazoflorTyclopyrazoflor is an anthranilamide compound with pesticidal activity. |
| Name | Tyclopyrazoflor |
|---|
| Description | Tyclopyrazoflor is an anthranilamide compound with pesticidal activity. |
|---|---|
| Related Catalog | |
| References |
[1]. WO 2017140563 A1. |
| Molecular Formula | C16H18ClF3N4OS |
|---|---|
| Molecular Weight | 406.85 |
| InChIKey | DBHVHTPMRCXCIY-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)CCSCCC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |