4-(2-Chloro-N-Methylacetamido)Benzoic Acid structure
|
Common Name | 4-(2-Chloro-N-Methylacetamido)Benzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 147149-44-8 | Molecular Weight | 227.64400 | |
| Density | 1.379g/cm3 | Boiling Point | 401ºC at 760mmHg | |
| Molecular Formula | C10H10ClNO3 | Melting Point | 188-190ºC | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | 4-[(2-chloroacetyl)-methylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 401ºC at 760mmHg |
| Melting Point | 188-190ºC |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64400 |
| Flash Point | 196.3ºC |
| Exact Mass | 227.03500 |
| PSA | 57.61000 |
| LogP | 1.58640 |
| Vapour Pressure | 3.76E-07mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | QKSXGBJMRZJGTM-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CCl)c1ccc(C(=O)O)cc1 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-METHYL-4-(2-CHLOROACETAMIDO)BENZOIC ACID |
| MFCD02093984 |
| 4-(2-chloro-N-methylacetylamino)benzoic acid |