Pyrido[2,3-b]pyrazine-2-carboxylicacid, 3,4-dihydro-4-methyl-3-oxo-, ethyl ester structure
|
Common Name | Pyrido[2,3-b]pyrazine-2-carboxylicacid, 3,4-dihydro-4-methyl-3-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1471-86-9 | Molecular Weight | 233.22300 | |
| Density | 1.35g/cm3 | Boiling Point | 388.1ºC at 760 mmHg | |
| Molecular Formula | C11H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.5ºC | |
| Name | ethyl 4-methyl-3-oxopyrido[2,3-b]pyrazine-2-carboxylate |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 388.1ºC at 760 mmHg |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.22300 |
| Flash Point | 188.5ºC |
| Exact Mass | 233.08000 |
| PSA | 74.08000 |
| LogP | 0.50520 |
| Vapour Pressure | 3.14E-06mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | GYYGTQJGBDODSU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc2cccnc2n(C)c1=O |
|
~85%
Pyrido[2,3-b]py... CAS#:1471-86-9 |
| Literature: Savelli, Francesco; Boido, Alessandro; Damonte, Gianluca Journal of Heterocyclic Chemistry, 1996 , vol. 33, # 6 p. 1737 - 1742 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |