2,4,6-Trimethoxybenzylamine hydrochloride structure
|
Common Name | 2,4,6-Trimethoxybenzylamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 146548-59-6 | Molecular Weight | 233.692 | |
| Density | 1.087g/cm3 | Boiling Point | 312ºC at 760mmHg | |
| Molecular Formula | C10H16ClNO3 | Melting Point | 204-207 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 151.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4,6-Trimethoxybenzylamine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 312ºC at 760mmHg |
| Melting Point | 204-207 °C(lit.) |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.692 |
| Flash Point | 151.1ºC |
| Exact Mass | 233.081863 |
| PSA | 53.71000 |
| LogP | 2.67340 |
| Vapour Pressure | 0.000544mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | BLFRMOOGAICNSZ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(CN)c(OC)c1.Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Facile synthesis of 3-(aminomethyl)isoquinolines by copper-catalysed domino four-component coupling and cyclisation.
Chem. Commun. (Camb.) (7) , 835-7, (2008) Copper(i)-catalysed domino four-component coupling-cyclisation using 2-ethynylbenzaldehydes, paraformaldehyde, secondary amine, and t-BuNH(2) in DMF leads to direct and efficient formation of 3-(amino... |
| (2,4,6-trimethoxyphenyl)methanamine,hydrochloride |
| MFCD00012855 |
| Benzenemethanamine, 2,4,6-trimethoxy-, hydrochloride (1:1) |
| (2,4,6-Trimethoxyphenyl)methanamine hydrochloride |
| 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (1:1) |