1-(2,4-dichlorophenyl)-2-methyl-5-phenyl-3-(pyrrolidin-1-ylmethyl)pyrrole structure
|
Common Name | 1-(2,4-dichlorophenyl)-2-methyl-5-phenyl-3-(pyrrolidin-1-ylmethyl)pyrrole | ||
|---|---|---|---|---|
| CAS Number | 146204-58-2 | Molecular Weight | 385.32900 | |
| Density | 1.23g/cm3 | Boiling Point | 502.2ºC at 760mmHg | |
| Molecular Formula | C22H22Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.5ºC | |
| Name | 1-(2,4-dichlorophenyl)-2-methyl-5-phenyl-3-(pyrrolidin-1-ylmethyl)pyrrole |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 502.2ºC at 760mmHg |
| Molecular Formula | C22H22Cl2N2 |
| Molecular Weight | 385.32900 |
| Flash Point | 257.5ºC |
| Exact Mass | 384.11600 |
| PSA | 8.17000 |
| LogP | 6.29320 |
| Vapour Pressure | 3.25E-10mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | HUCXUACOAARZJA-UHFFFAOYSA-N |
| SMILES | Cc1c(CN2CCCC2)cc(-c2ccccc2)n1-c1ccc(Cl)cc1Cl |
|
~30%
1-(2,4-dichloro... CAS#:146204-58-2 |
| Literature: Cerreto; Villa; Retico; Scalzo European Journal of Medicinal Chemistry, 1992 , vol. 27, # 7 p. 701 - 708 |
|
~%
1-(2,4-dichloro... CAS#:146204-58-2 |
| Literature: Cerreto; Villa; Retico; Scalzo European Journal of Medicinal Chemistry, 1992 , vol. 27, # 7 p. 701 - 708 |
|
~%
1-(2,4-dichloro... CAS#:146204-58-2 |
| Literature: Cerreto; Villa; Retico; Scalzo European Journal of Medicinal Chemistry, 1992 , vol. 27, # 7 p. 701 - 708 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |