Acetamide, N-(4-ethylphenyl)-2,2,2-trifluoro- structure
|
Common Name | Acetamide, N-(4-ethylphenyl)-2,2,2-trifluoro- | ||
|---|---|---|---|---|
| CAS Number | 14618-46-3 | Molecular Weight | 217.18800 | |
| Density | 1.264g/cm3 | Boiling Point | 275.1ºC at 760mmHg | |
| Molecular Formula | C10H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.2ºC | |
| Name | N-(4-ethylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 275.1ºC at 760mmHg |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.18800 |
| Flash Point | 120.2ºC |
| Exact Mass | 217.07100 |
| PSA | 29.10000 |
| LogP | 2.82280 |
| Vapour Pressure | 0.0052mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | VEYAGSUQCDESMW-UHFFFAOYSA-N |
| SMILES | CCc1ccc(NC(=O)C(F)(F)F)cc1 |
| HS Code | 2924299090 |
|---|
|
~60%
Acetamide, N-(4... CAS#:14618-46-3 |
| Literature: Vigorita; Previtera; Saporito; Costa De Pasquale; Circosta; Occhiuto Farmaco, Edizione Scientifica, 1984 , vol. 39, # 5 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Ethyl-2,2,2-trifluoroacetanilide |
| ACETANILIDE,4'-ETHYL-2,2,2-TRIFLUORO |
| N-<4-Aethyl-phenyl>-trifluoracetamid |